2015-08-23 14:41  NiLuJe

	* [r12287] src/install.sh:
	  
	  Kindle Hacks:
	  * Make sure xzdec is executable before trying to launch it in install
	  scripts....
	  Oooops. Fixes installation on a number of setups.

2015-08-20 16:50  NiLuJe

	* [r12267] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-08-18 21:44  NiLuJe

	* [r12249] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v5.16.N
	  * Python:
	  * Tag v0.14.N
	  * ScreenSavers:
	  * Tag v0.47.N
	  * USBNetwork:
	  * Tag v0.57.N

2015-08-18 20:14  NiLuJe

	* [r12247] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Fix some K5 device checks to handle the KV/KT2/PW3 in various KUAL
	  menus

2015-08-18 16:19  NiLuJe

	* [r12244] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Wow. That was another amazing typo. >_<"

2015-08-18 15:56  NiLuJe

	* [r12242] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Don't clutter the src packages with an arm zxdec binary

2015-08-18 15:41  NiLuJe

	* [r12241] README:
	  
	  Kindle Hacks:
	  * Update credits for xzdec :).

2015-08-18 15:25  NiLuJe

	* [r12237] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Oops, forgot the K4 xzdec binary ;).

2015-08-18 15:21  NiLuJe

	* [r12236] src/build-updates.sh, src/install.sh:
	  
	  Kindle Hacks:
	  * Switch from bzip2 archives to xz archives. Smaller, faster, better.
	  :).

2015-08-16 10:33  NiLuJe

	* [r12203] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Refresh binaries (TC update)

2015-08-15 09:46  NiLuJe

	* [r12172] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-08-14 09:39  NiLuJe

	* [r12137] src/linkss/bin/convert, src/linkss/lib/libpng16.so.16:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-07-30 06:39  NiLuJe

	* [r12103] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-07-27 03:04  NiLuJe

	* [r12097] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-07-26 23:30  NiLuJe

	* [r12090] src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * More accurate log in case of cover processing failure

2015-07-25 18:36  NiLuJe

	* [r12086] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  And a final round of VSN keyword pruning...

2015-07-25 18:30  NiLuJe

	* [r12084] src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Fix some more nonsensical keywords on binary files...

2015-07-25 17:45  NiLuJe

	* [r12080] src/linkss/bin/convert, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-06-17 01:45  NiLuJe

	* [r12038] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries (update IM to fix a ScreenSavers regression)

2015-06-16 23:26  NiLuJe

	* [r12036] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * More comments polishing

2015-06-16 23:24  NiLuJe

	* [r12035] src/linkss/bin/cover-extract:
	  
	  Kindle Touch Hacks:
	  * ScreenSavers:
	  * Forgot to document one more weird side-effect on the 'broken' IM
	  versions...

2015-06-16 23:18  NiLuJe

	* [r12034] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Put the IM/eips thing to rest (for now). It'll be fixed once the new
	  binaries are up.

2015-06-16 21:36  NiLuJe

	* [r12030] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak IM PNG conversion details to fix a regression with the latest
	  IM builds.
	  (eips was choking on our images because the colormap generation was
	  skipped by default on greyscale image)

2015-06-13 14:57  NiLuJe

	* [r12025] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-06-05 22:17  NiLuJe

	* [r12019] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  • Refresh binaries

2015-05-31 01:14  NiLuJe

	* [r12014] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-05-25 18:33  NiLuJe

	* [r12003] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-05-08 15:42  NiLuJe

	* [r11977] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v5.15.N
	  * Python:
	  * Tag v0.13.N
	  * ScreenSavers:
	  * Tag v0.46.N
	  * USBNet:
	  * Tag v0.56.N

2015-05-07 22:32  NiLuJe

	* [r11963] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Update binaries (updated TC)

2015-05-01 02:02  NiLuJe

	* [r11924] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/delegates.xml,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Update binaries

2015-04-28 19:31  NiLuJe

	* [r11910] src/build-updates.sh:
	  
	  The great shebang enfixening!

2015-03-11 00:58  NiLuJe

	* [r11729] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-03-10 18:02  NiLuJe

	* [r11726] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Flush FS buffers after switching to a new cover. Feels overkill and
	  stupid, but who knows, it might help jog the framework.

2015-03-07 16:23  NiLuJe

	* [r11725] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-03-07 01:28  NiLuJe

	* [r11720] src/linkss/bin/convert, src/linkss/lib/libpng16.so.16:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-02-26 03:38  NiLuJe

	* [r11686] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Avoid lbzip2 entirely for stuff that'll be processed on the
	  device...
	  Even without the -u flag, the Kindle's crappy busybox version
	  sometimes
	  chokes on it...

2015-02-26 02:23  NiLuJe

	* [r11684] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Refresh bianries...
	  (LTO, AKA, The Breakening!)

2015-02-25 15:00  NiLuJe

	* [r11663] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml,
	  src/linkss/etc/ImageMagick-6/type-dejavu.xml,
	  src/linkss/etc/ImageMagick-6/type-ghostscript.xml,
	  src/linkss/etc/ImageMagick-6/type.xml:
	  
	  Kindle Hacks:
	  • Resync binaries

2015-02-23 23:36  NiLuJe

	* [r11624] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Don't use lbzip2's -u flag: busybox's bzip2 doesn't seem to handle
	  archives created that way...

2015-02-23 22:30  NiLuJe

	* [r11620] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Parallelize compression in buildscripts... (lbzip2, pigz & threaded
	  xz)

2015-02-23 02:18  NiLuJe

	* [r11604] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * refresh binaries (fix readline)

2015-02-22 14:25  NiLuJe

	* [r11576] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-02-20 06:30  NiLuJe

	* [r11558] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (fix strace)

2015-02-19 23:37  NiLuJe

	* [r11554] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (strace w/ libunwind, Python & SQLite3 w/ readline)

2015-02-18 22:12  NiLuJe

	* [r11545] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Oops. Unified uninstall packages means they ought to be able to run
	  on all the unified devices ;D.

2015-02-18 22:09  NiLuJe

	* [r11544] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Unify uninstall packages when building MRPI-only packages

2015-02-18 21:56  NiLuJe

	* [r11543] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Default to building OTAv2 packages, even for legacy hacks.
	  The downside is they'll only be installable through MRPI.
	  The upside is the packages are seventy billion times smaller,
	  and the mess of seventy billion different update files to
	  choose from is gone.

2015-02-18 21:19  NiLuJe

	* [r11541] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Update binaries (widec ncurses)

2015-02-17 23:35  NiLuJe

	* [r11537] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Refresh binaries (Linaro 4.9 2015.02)

2015-02-17 18:57  NiLuJe

	* [r11526] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Touch Hacks:
	  * ScreenSavers:
	  * Fix the "framework restart" button.
	  Do a stop && start instead of a restart, so that our stop on/start on
	  stanzas are honored.
	  With a simple restart, linkss wasn't going down & up, which made it
	  mostly useless as a means
	  to take new settings into account.

2015-02-16 18:05  NiLuJe

	* [r11521] src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Minor typo in a comment

2015-02-12 18:23  NiLuJe

	* [r11499] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Update binaries

2015-01-31 19:58  NiLuJe

	* [r11464] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-01-17 20:34  NiLuJe

	* [r11432] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml,
	  src/linkss/etc/ImageMagick-6/policy.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2015-01-05 23:16  NiLuJe

	* [r11332] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml,
	  src/linkss/etc/ImageMagick-6/policy.xml,
	  src/linkss/lib/libpng16.so.16:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-12-18 13:05  NiLuJe

	* [r11252] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/lib/libpng16.so.16, src/linkss/lib/libz.so.1:
	  
	  Kindle Hacks:
	  * Refresh binaires (updated TC)

2014-12-07 14:22  NiLuJe

	* [r11231] src/uninstall.sh:
	  
	  Kindle Hacks:
	  * Ooops. Fix complete uninstalls. Remove the KUAL extensions *before*
	  the hack folder, or we lose the trigger file ;p

2014-12-02 18:38  NiLuJe

	* [r11218] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * Make sure our mounted flags don't disappear into the ether if for
	  some reason an unmount failed at one point

2014-11-28 20:46  NiLuJe

	* [r11172] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-25 21:29  NiLuJe

	* [r11168] src/linkss/bin/convert, src/linkss/lib/libpng16.so.16:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-23 20:44  NiLuJe

	* [r11150] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * Oooh, I can't spell ;).

2014-11-22 18:45  NiLuJe

	* [r11135] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-22 16:23  NiLuJe

	* [r11129] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * Use a more reliable method to check the current UID,
	  the env cannot be trusted.

2014-11-22 15:30  NiLuJe

	* [r11127] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * More safety nets around the FW 5.6.1 mess...

2014-11-17 18:12  NiLuJe

	* [r11112] src/extensions/linkss/bin/linkss.sh,
	  src/linkss/bin/cover-watchdog, src/linkss/bin/screensaver-watchdog,
	  src/linkss/bin/userstore-watchdog:
	  
	  Kindle Hacks:
	  * Tweak some broken eips calls (invalid chars)

2014-11-15 21:03  NiLuJe

	* [r11085] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-14 18:47  NiLuJe

	* [r11072] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-08 15:52  NiLuJe

	* [r11054] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-07 19:57  NiLuJe

	* [r11046] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-11-07 18:54  NiLuJe

	* [r11043] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * Second pass of Kindle Voyage support...

2014-11-05 18:09  NiLuJe

	* [r11032] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-10-25 00:45  NiLuJe

	* [r10999] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  • JailBreak:
	  • Tag v0.13.N
	  • Python:
	  • Tag v0.11.N
	  • ScreenSavers;
	  • Tag v0.45.N
	  • Fonts:
	  • Tag v5.14.N
	  • USBNetwork:
	  • Tag v0.55.N

2014-10-25 00:05  NiLuJe

	* [r10996] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-10-18 02:31  NiLuJe

	* [r10971] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-10-08 20:07  NiLuJe

	* [r10961] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml,
	  src/linkss/lib/libpng16.so.16[ADD], src/linkss/lib/libz.so.1[ADD]:
	  
	  Kindle Hacks:
	  * Refresh binaries (introduce strace & friends)

2014-10-08 16:44  NiLuJe

	* [r10958] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Handle the new binaries properly when building split packages...

2014-10-08 15:25  NiLuJe

	* [r10954] src/linkss/lib[ADD]:
	  
	  Kindle Hacks:
	  * X-TC:
	  * Build & ship w/ USBNet strace, some elfutils tools & ltrace

2014-10-06 17:00  NiLuJe

	* [r10950] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-09-27 15:33  NiLuJe

	* [r10933] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-09-05 19:38  NiLuJe

	* [r10916] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-09-02 01:25  NiLuJe

	* [r10893] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-08-26 03:51  NiLuJe

	* [r10853] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (Python w/ SQLite3, DropBear KeepAlive + PuTTy fix)

2014-08-22 21:00  NiLuJe

	* [r10841] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries (updated TC)

2014-08-13 18:50  NiLuJe

	* [r10829] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-08-12 03:49  NiLuJe

	* [r10827] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-30 04:32  NiLuJe

	* [r10783] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Updated TC, first GCC 4.9 builds)

2014-07-28 18:08  NiLuJe

	* [r10778] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-28 01:52  NiLuJe

	* [r10774] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-27 20:24  NiLuJe

	* [r10766] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries ;).

2014-07-26 21:30  NiLuJe

	* [r10751] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-24 18:31  NiLuJe

	* [r10726] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-12 22:55  NiLuJe

	* [r10711] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-07-05 15:12  NiLuJe

	* [r10693] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-06-30 23:59  NiLuJe

	* [r10685] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-06-27 01:27  NiLuJe

	* [r10681] src/build-updates.sh, src/install.sh, src/uninstall.sh:
	  
	  Kindle Hacks:
	  * Move everyone to LibOTAUtils

2014-06-24 23:01  NiLuJe

	* [r10662] src/build-updates.sh:
	  
	  Kindle Hacks:
	  • More portability fixes for the build scripts

2014-06-22 04:06  NiLuJe

	* [r10650] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-06-18 22:18  NiLuJe

	* [r10617] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-06-18 21:25  NiLuJe

	* [r10613] README:
	  
	  Kindle Hacks:
	  * Update CREDITS for fbgrab, harfbuzz & zlib

2014-06-06 17:30  NiLuJe

	* [r10585] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-05-31 00:41  NiLuJe

	* [r10571] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Shorten some possibly too long KUAL status messages...

2014-05-30 23:21  NiLuJe

	* [r10569] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.44.N

2014-05-30 23:18  NiLuJe

	* [r10568] src/linkss/bin/cover-watchdog:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Unbreak the cover mode, which spectacularly blew up in the 0.43
	  release,
	  because of a regression in inotify-tools...
	  (cf.
	  https://github.com/rvoicilas/inotify-tools/commit/a85bab14d86ff6a38625440d1e7c364a5cf9d7dc)
	  Even if it has now been fixed upstream, be more specific on out end by
	  specifying that we don't want to timeout, ever.
	  
	  Massive thanks to CmdrCrabapple for noticing and complaining, since
	  that version has now been out for two months, and cover
	  mode was really *spectacularly* broken... (I failed to notice this
	  during testing because I was already using a newer, fixed, inotifywait
	  binary...)

2014-05-26 09:33  NiLuJe

	* [r10562] src/uninstall.sh:
	  
	  Kindle Hacks
	  • Proper logging on full uninstall

2014-05-18 01:10  NiLuJe

	* [r10554] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-05-10 04:32  NiLuJe

	* [r10531] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-04-26 21:15  NiLuJe

	* [r10498] src/linkss/bin/convert, src/linkss/bin/inotifywait:
	  
	  Kindle Hacks:
	  * Refresh binaries (minor updates, and the whole FT w/ HB thing)

2014-04-11 13:08  NiLuJe

	* [r10460] src/build-updates.sh, src/linkss/info.txt:
	  
	  KUAL Extensions:
	  * gawk:
	  * Tag v1.3.N
	  Kindle Touch Hacks:
	  * JailBreak:
	  * Tag v1.10.N
	  * USBNetwork:
	  * Tag v0.16.N
	  * ScreenSavers:
	  * Tag v0.17.N
	  * Python:
	  * Tag v0.10.N
	  * Fonts:
	  * Tag v0.8.N
	  Kindle Hacks:
	  * JailBreak:
	  * Tag v0.12.N
	  * ScreenSavers:
	  * Tag v0.43.N
	  * Fonts:
	  * Tag v5.13.N
	  * USBNetwork:
	  * Tag v0.54.N
	  * Python:
	  * Tag v0.10.N

2014-04-11 12:12  NiLuJe

	* [r10459] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Linaro 2014.04)

2014-03-25 06:25  NiLuJe

	* [r10435] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2014-03-15 23:23  NiLuJe

	* [r10420] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Updated TC)

2014-03-08 23:08  NiLuJe

	* [r10409] src/uninstall.sh:
	  
	  Kindle Hacks:
	  * Remove KUAL extensions in full uninstall mode

2014-03-06 22:55  NiLuJe

	* [r10405] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix a c/p oversight. No pinfo support in the legacy version ;).

2014-03-06 22:40  NiLuJe

	* [r10402] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (bump FT, FC, IM, KindleTool; dropbear)

2014-02-14 17:44  NiLuJe

	* [r10330] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Optionally handle periodicals in cover mode

2014-02-14 17:27  NiLuJe

	* [r10328] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Use Update_*.bin package filenames instead of update_*.bin,
	  to avoid triggering the recovery updater on boot. (thanks, dsmid ;))

2014-02-14 16:58  NiLuJe

	* [r10327] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries (Update TC)

2014-01-24 23:51  NiLuJe

	* [r10320] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  • Refresh binaries (updated TC)

2014-01-09 22:55  NiLuJe

	* [r10300] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Update binaries (updated TC)

2014-01-09 21:45  NiLuJe

	* [r10299] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Add a "complete uninstall" button to the KUAL extensions.
	  Makes the uninstallers remove the hack directory from the userstore.

2013-12-23 14:32  NiLuJe

	* [r10248] src/linkss/bin/convert, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-12-10 19:05  NiLuJe

	* [r10218] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-12-08 02:49  NiLuJe

	* [r10213] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-12-03 19:47  NiLuJe

	* [r10194] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (Update FT, FC, DB, LA, Python)

2013-11-30 18:26  NiLuJe

	* [r10186] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-11-28 19:49  NiLuJe

	* [r10182] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (update FT, FC, silence an OpenSSH warning on the
	  PW2)

2013-11-23 18:11  NiLuJe

	* [r10163] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Build PW2-specific packages

2013-11-23 17:53  NiLuJe

	* [r10161] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Switch to --exclude-vcs everywhere

2013-11-23 16:47  NiLuJe

	* [r10158] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (Add PW2 binaries)

2013-11-19 23:48  NiLuJe

	* [r10119] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (Hopefully, fix OpenSSH on FW >= 5.3.9)

2013-11-18 19:39  NiLuJe

	* [r10115] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (TC update)

2013-11-17 16:08  NiLuJe

	* [r10101] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Add a KUAL button to show the exact version of the package
	  installed.
	  It helps with my rolling releases snapshots, for example ;).

2013-11-16 17:16  NiLuJe

	* [r10097] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-11-15 16:29  NiLuJe

	* [r10085] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Go back to using the Gray colorspace. IM defaults to sensible
	  settings,
	  and it appears for some mysterious reason to be faster than asking for
	  Rec709Luma ourselves :?

2013-11-15 16:20  NiLuJe

	* [r10083] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Some notes about GraphicsMagick (and why we're not using it)

2013-11-15 15:50  NiLuJe

	* [r10082] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Switch to the ITU-R BT.709-5 Gray colorspace, and not the legacy
	  one.

2013-11-12 17:59  NiLuJe

	* [r10067] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (again, mostly for KindleTool)

2013-11-11 00:40  NiLuJe

	* [r10058] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries...

2013-11-10 23:42  NiLuJe

	* [r10056] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-11-01 00:56  NiLuJe

	* [r10015] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-10-17 18:44  NiLuJe

	* [r9974] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.42.N
	  * Fonts:
	  * Tag v5.12.N
	  * USBNetwork:
	  * Tag v0.53.N
	  * Python:
	  * Tag v0.8.N

2013-10-17 18:34  NiLuJe

	* [r9971] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (TC update)

2013-10-11 22:19  NiLuJe

	* [r9945] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-10-05 13:11  NiLuJe

	* [r9914] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * KUAL extensions:
	  * Detect the PW2

2013-09-25 16:03  NiLuJe

	* [r9888] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-09-25 15:23  NiLuJe

	* [r9886] src/build-updates.sh, src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Use bzip2 to save some space

2013-09-25 02:06  NiLuJe

	* [r9877] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * USBNet:
	  * Bundle OpenSSL. (OpenSSH's ssh segfaults during the hostkey exchange
	  on FW 2.x otherwise)

2013-09-24 21:49  NiLuJe

	* [r9865] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FT & FC binaries (update ft & fc)
	  * USBNet:
	  * Bundle the full OpenSSH suite (client & co)
	  * Bundle sshfs (thanks to twobob for the push ;p)

2013-09-20 13:56  NiLuJe

	* [r9843] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries, mainyl for an FT update that fix glyph cropping
	  for emboldened font

2013-09-19 20:17  NiLuJe

	* [r9832] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Sleep a bit more to account for cold screens

2013-09-19 19:23  NiLuJe

	* [r9831] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix eips calls for the cover preview on legacy devices

2013-09-19 18:50  NiLuJe

	* [r9830] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Do our best to get rid of any ghosting when previewing the active
	  cover

2013-09-19 18:41  NiLuJe

	* [r9829] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Less regexy awk call to check for freespace

2013-09-19 18:37  NiLuJe

	* [r9828] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix the cover preview...

2013-09-19 18:25  NiLuJe

	* [r9827] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Add a KUAL button to preview the current active screensaver in cover
	  mode

2013-09-19 17:51  NiLuJe

	* [r9824] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.41.N

2013-09-18 14:48  NiLuJe

	* [r9817] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Clear the cache folder in case KindleUNpack fails to extract a
	  cover,
	  in case I messed up and it left something behind...
	  * MobiCover:
	  * Fix a regression where a combo file with a cover in the M7 part,
	  but not in the KF8 part would make KindleUnpack believe that it
	  couldn't
	  find any cover at all (scope issue, the latest part [KF8] took
	  precedence).

2013-09-18 13:27  NiLuJe

	* [r9816] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Tag v0.51.N
	  * Fonts:
	  * Tag v5.11.N
	  * Python:
	  * Tag v0.7.N
	  * ScreenSavers:
	  * Tag v0.40.N

2013-09-18 12:54  NiLuJe

	* [r9811] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Refresh binaries (Linaro 4.8 2013.09)

2013-08-16 23:42  NiLuJe

	* [r9735] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Screen Savers:
	  * Tag v0.39.N
	  * Fonts:
	  * Tag v5.10.N
	  * USBNet:
	  * Tag v0.50.N
	  * Python:
	  * Tag v0.6.N

2013-08-16 23:34  NiLuJe

	* [r9734] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Linaro 2013.08)

2013-08-13 19:31  NiLuJe

	* [r9727] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * Tweak some comments

2013-08-12 18:24  NiLuJe

	* [r9714] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Touch Hacks:
	  * Fix our traps in the KUAL restart X/framework buttons to avoid
	  messing with upstart...

2013-08-12 04:09  NiLuJe

	* [r9704] src/linkss/bin/convert,
	  src/linkss/etc/ImageMagick-6/delegates.xml:
	  
	  Kindle Hacks:
	  * Binary refreshes, without the crazy FT patch.

2013-08-02 23:36  NiLuJe

	* [r9651] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Touch Hacks:
	  * Properly increment the progress bar when triggering a framework
	  restart through KUAL

2013-08-02 21:23  NiLuJe

	* [r9650] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Touch Hacks:
	  * Apparently, we need to handle the progress bar ourselves...

2013-08-02 21:04  NiLuJe

	* [r9649] src/install.sh, src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * Don't set PYTHONHOME anymore when calling Python, it's not needed
	  anymore

2013-08-02 21:03  NiLuJe

	* [r9647] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Touch Hacks:
	  * Show the progress bar splash screen when we trigger a framework
	  restart

2013-08-02 19:57  NiLuJe

	* [r9642] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (fix Python ssl & pyexpat modules)

2013-07-31 15:16  NiLuJe

	* [r9621] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Linaro 4.8-2013.07-1)

2013-07-31 14:35  NiLuJe

	* [r9620] src/extensions/linkss/menu.json:
	  
	  Kindle Touch Hacks:
	  * Reflect the new K5 autoreboot default in the menu & docs

2013-07-31 14:22  NiLuJe

	* [r9618] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Add a framework restart button to the Fonts & SS KUAL menus

2013-07-29 23:23  NiLuJe

	* [r9570] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries, fix fc-scan

2013-07-24 16:29  NiLuJe

	* [r9540] src/build-updates.sh, src/linkss/bin/usb-watchdog[DEL],
	  src/linkss/bin/usb-watchdog-helper[DEL]:
	  
	  Kindle Hacks:
	  * Move usb-watchdog to common, so I only have one copy to maintain

2013-07-24 16:23  NiLuJe

	* [r9539] src/build-updates.sh, src/linkss/bin/libkh[DEL]:
	  
	  Kindle Hacks:
	  * Move libkh to a common directory, so I don't have eleventy copies to
	  maintain

2013-07-18 15:49  NiLuJe

	* [r9525] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries

2013-07-16 16:00  NiLuJe

	* [r9509] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Honor the verbose flag in the KUAL scripts, now that the custom
	  status print works
	  in the latest KUAL snapshots.

2013-07-14 16:15  NiLuJe

	* [r9505] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries. (Go back to ARM instruction set on the K5,
	  Tweak IM to be less memory hungry (q8, CacheShift 3)).

2013-07-14 16:09  NiLuJe

	* [r9504] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json, src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make the dithering algorithm configurable

2013-07-14 15:56  NiLuJe

	* [r9503] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak the dithering settings/comments for the next IM build (q8,
	  CacheShift 3)

2013-07-14 02:47  NiLuJe

	* [r9499] src/install.sh:
	  
	  Kindle Hacks:
	  * Keep the current autoreboot config when updating

2013-07-14 01:42  NiLuJe

	* [r9498] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * Amend docs for the OOM symptoms IM's memhungry dithering can trigger

2013-07-14 01:16  NiLuJe

	* [r9496] src/linkss/bin/cover-extract:
	  
	  Kindle Touch Hacks:
	  * ScreenSavers:
	  * Think about limiting the life expectancy of an IM process...

2013-07-14 00:38  NiLuJe

	* [r9494] src/extensions/linkss/bin/linkss.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak a KUAL print

2013-07-14 00:11  NiLuJe

	* [r9492] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json, src/linkss/bin/cover-extract,
	  src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make dithering configurable (via the lowmem switch) because it eats
	  a fuckload of RAM, to the point of swapping on some devices.

2013-07-13 19:40  NiLuJe

	* [r9487] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * X-TC:
	  * Tag v2013.07.N
	  * ScreenSavers:
	  * Tag v0.38.N
	  * Fonts:
	  * Tag v5.9.N
	  * Python:
	  * Tag v0.5.N
	  * USBNetwork:
	  * Tag v0.49.N
	  Kindle Touch Hacks:
	  * Python:
	  * Tag v0.5.N
	  * ScreenSavers:
	  * Tag v0.11.N
	  * USBNetwork:
	  * Tag v0.9.N

2013-07-13 18:21  NiLuJe

	* [r9486] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh binaries (Bump to TC Linaro 2013.07)

2013-07-13 18:18  NiLuJe

	* [r9485] src/linkss/bin/cover-extract,
	  src/linkss/etc/kindle_colors.gif[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Backport the dithering tweaks form the K5 version

2013-07-12 21:40  NiLuJe

	* [r9482] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Properly handle the KindleDX w/ latest KUAL snapshots

2013-07-07 15:18  NiLuJe

	* [r9453] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.37.N

2013-07-07 15:00  NiLuJe

	* [r9451] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Be a little more lenient with uppercase files, even if I don't
	  really like it... ;)

2013-07-07 03:59  NiLuJe

	* [r9449] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak the eips messages so that they don't overrun

2013-07-07 03:47  NiLuJe

	* [r9448] src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Oops, fix first sleep after a book switch...

2013-07-07 03:31  NiLuJe

	* [r9447] src/linkss/bin/cover-extract, src/linkss/bin/cover-watchdog,
	  src/linkss/bin/libkh, src/linkss/bin/linkss, src/linkss/bin/shuffless,
	  src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Backport the tmpfs+symlink changes from the K5 hack to avoid some
	  unnecessary IO
	  * Potentially avoid triggering an extra inotify event ourselves on
	  reader.pref...

2013-07-05 01:25  NiLuJe

	* [r9438] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kinde Touch Hacks:
	  * ScreenSavers:
	  * Experimental beta button added to the KUAL menu

2013-07-05 00:38  NiLuJe

	* [r9436] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.36.N

2013-07-05 00:31  NiLuJe

	* [r9433] src/linkss/cover_cache/default-600x800.png,
	  src/linkss/cover_cache/default-824x1200.png:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak the default cover mode image to be a bit more helpful than a
	  blank screen ;).

2013-07-04 22:24  NiLuJe

	* [r9428] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries (update FC snapshot)

2013-07-02 20:19  NiLuJe

	* [r9417] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * KUAL: use checked: true w/ refresh: false

2013-07-02 03:39  NiLuJe

	* [r9401] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Refresh binaries. Link ImageMagick (libpng) & Python against a
	  static zlib to avoid symbol versioning issues.
	  (it broke opening PNG files for IM, which in turn broke the pinfo
	  support in the ScreenSavers hack).

2013-07-02 01:50  NiLuJe

	* [r9395] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Minor tweaks to the KUAL menu for K5 devices

2013-07-02 00:41  NiLuJe

	* [r9393] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Oops, bundle the KUAL extension in K4 packages, too...

2013-07-01 22:04  NiLuJe

	* [r9390] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Tag v0.48.N
	  * Python:
	  * Tag v0.4.N
	  * ScreenSavers:
	  * Tag v0.35.N
	  * Fonts:
	  * Tag v5.8.N

2013-07-01 21:46  NiLuJe

	* [r9387] src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * Make a few comments more accurate...

2013-07-01 20:28  NiLuJe

	* [r9384] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * KUAL: Fix -m tests (I still suck at RPN ;D)

2013-07-01 20:14  NiLuJe

	* [r9383] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * Switch to usig -m in KUAL extensions

2013-07-01 18:55  NiLuJe

	* [r9382] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * KUAL: Oops, had forgotten about the shuffle mode... ;)

2013-07-01 18:50  NiLuJe

	* [r9381] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json,
	  src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make the sleep workaround for the potentially iffy first sleep cycle
	  after a book switch configurable

2013-07-01 18:35  NiLuJe

	* [r9380] src/linkss/bin/cover-watchdog-helper, src/linkss/bin/linkss,
	  src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Some minor tweaks to the new watchdog traps

2013-07-01 01:49  NiLuJe

	* [r9376] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Kill the process_staging stub, it's not our job (and the legacy hack
	  doesn't have a staging folder anyway)

2013-07-01 01:30  NiLuJe

	* [r9370] src/linkss/bin/screensaver-watchdog,
	  src/linkss/bin/usb-watchdog, src/linkss/bin/userstore-watchdog:
	  
	  Kindle Hacks:
	  * Fix a typo in the comments

2013-07-01 01:24  NiLuJe

	* [r9368] src/linkss/bin/linkss, src/linkss/bin/screensaver-watchdog,
	  src/linkss/bin/unlinkss, src/linkss/bin/usb-watchdog,
	  src/linkss/bin/userstore-watchdog:
	  
	  Kindle Hacks:
	  * Be more gentle when killing stuff (SIGTERM instead of SIGKILL) to
	  let the
	  trap handlers we've laid handle some minor cleanup...

2013-07-01 01:11  NiLuJe

	* [r9367] src/linkss/bin/cover-watchdog,
	  src/linkss/bin/cover-watchdog-helper,
	  src/linkss/bin/userstore-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Try harder at not leaving inotifywait hanging alone...
	  Hopefully this will help with the issues some people have experienced
	  with the cover mode taking a nap sometimes... (Thanks to PoP for
	  helping
	  track this one ;)).

2013-06-29 00:40  NiLuJe

	* [r9366] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Bundle & install the KUAL extension

2013-06-29 00:21  NiLuJe

	* [r9364] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Refresh menu on behavor reset

2013-06-29 00:18  NiLuJe

	* [r9363] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Nearly done with the KUAL extension!

2013-06-29 00:05  NiLuJe

	* [r9362] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * KUAL: Use a different regex for the -m workaround. Potentially less
	  hairy ;D

2013-06-29 00:02  NiLuJe

	* [r9361] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * More KUAL stuff done

2013-06-28 23:43  NiLuJe

	* [r9360] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * KUAL: Hmm, shiny regex workaround ;D

2013-06-28 23:19  NiLuJe

	* [r9359] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Don't show the cover mode settings submenu if we're not in cover
	  mode

2013-06-28 23:07  NiLuJe

	* [r9358] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * RPN strikes again! RPN: 2, NiLuJe: 1 :D

2013-06-28 22:57  NiLuJe

	* [r9357] src/extensions/linkss/bin/linkss.sh,
	  src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * KUAL: Only show the autoreboot trigger menu if autoreboot is enabled

2013-06-28 03:43  NiLuJe

	* [r9355] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Add a tool entry to reset to default settings

2013-06-28 03:42  NiLuJe

	* [r9354] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Only show the border settings if we're in letterbox mode

2013-06-28 03:13  NiLuJe

	* [r9353] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * KUAL extensions: Fix a bunch of issues (namely, I suck at RPN, and
	  the -m operator isn't implemented)

2013-06-28 02:18  NiLuJe

	* [r9352] src/extensions/linkss/menu.json:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * More KUAl FIXMEs

2013-06-28 02:16  NiLuJe

	* [r9351] src/extensions[ADD], src/extensions/linkss[ADD],
	  src/extensions/linkss/bin[ADD],
	  src/extensions/linkss/bin/linkss.sh[ADD],
	  src/extensions/linkss/config.xml[ADD],
	  src/extensions/linkss/menu.json[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Initial import of the skeleton of the KUAl extension

2013-06-24 23:18  NiLuJe

	* [r9330] src/linkss/bin/convert:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Get rid of the bci_new ft lib, now that it's redundant
	  (FT dropped support for OLD_INTERNALS, and I can't
	  reproduce any of the issues that led me to using it in the first
	  place)

2013-06-24 20:15  NiLuJe

	* [r9325] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Make all build scripts automatically bomb out on non 0 return codes,
	  so I can safely catch
	  snafus during my full rebuilds...

2013-06-24 19:39  NiLuJe

	* [r9322] src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Make the uninstall hint in the info.txt a little bit clearer,
	  following a suggestion
	  by mitakka
	  (http://www.mobileread.com/forums/showpost.php?p=2447890&postcount=3026)

2013-06-23 21:58  NiLuJe

	* [r9314] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort,
	  src/linkss/etc/ImageMagick-6/coder.xml[ADD],
	  src/linkss/etc/ImageMagick-6/colors.xml[ADD],
	  src/linkss/etc/ImageMagick-6/delegates.xml[ADD],
	  src/linkss/etc/ImageMagick-6/log.xml[ADD],
	  src/linkss/etc/ImageMagick-6/magic.xml[ADD],
	  src/linkss/etc/ImageMagick-6/mime.xml[ADD],
	  src/linkss/etc/ImageMagick-6/policy.xml[ADD],
	  src/linkss/etc/ImageMagick-6/quantization-table.xml[ADD],
	  src/linkss/etc/ImageMagick-6/thresholds.xml[ADD],
	  src/linkss/etc/ImageMagick-6/type-dejavu.xml[ADD],
	  src/linkss/etc/ImageMagick-6/type-ghostscript.xml[ADD],
	  src/linkss/etc/ImageMagick-6/type-windows.xml[ADD],
	  src/linkss/etc/ImageMagick-6/type.xml[ADD]:
	  
	  Kindle Hacks:
	  * Update ALL THE THINGS!

2013-06-23 17:50  NiLuJe

	* [r9312] src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Handle the ImageMagick config migration

2013-06-23 17:50  NiLuJe

	* [r9311] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix cover processing with latest ImageMagick...

2013-06-23 16:57  NiLuJe

	* [r9309] src/linkss/etc/ImageMagick[DEL],
	  src/linkss/etc/ImageMagick-6[CPY],
	  src/linkss/etc/ImageMagick-6/coder.xml[DEL],
	  src/linkss/etc/ImageMagick-6/colors.xml[DEL],
	  src/linkss/etc/ImageMagick-6/delegates.xml[DEL],
	  src/linkss/etc/ImageMagick-6/log.xml[DEL],
	  src/linkss/etc/ImageMagick-6/magic.xml[DEL],
	  src/linkss/etc/ImageMagick-6/mime.xml[DEL],
	  src/linkss/etc/ImageMagick-6/policy.xml[DEL],
	  src/linkss/etc/ImageMagick-6/quantization-table.xml[DEL],
	  src/linkss/etc/ImageMagick-6/thresholds.xml[DEL],
	  src/linkss/etc/ImageMagick-6/type-dejavu.xml[DEL],
	  src/linkss/etc/ImageMagick-6/type-ghostscript.xml[DEL],
	  src/linkss/etc/ImageMagick-6/type-windows.xml[DEL],
	  src/linkss/etc/ImageMagick-6/type.xml[DEL]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Move to IM 6.8

2013-06-18 22:46  NiLuJe

	* [r9283] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make this one IM 6.8 ready too..

2013-04-26 16:52  NiLuJe

	* [r9096] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Detect the Brazilian 3G PaperWhite as such

2013-01-29 15:47  NiLuJe

	* [r9049] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Resync libkh with libkh5 (PW detect)

2013-01-21 22:51  NiLuJe

	* [r9038] src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Oops. Forgot to update the info.txt files. -_-"

2013-01-19 21:10  NiLuJe

	* [r9036] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Tag v0.47.N
	  * Fonts:
	  * Tag v5.7.N
	  * ScreenSavers:
	  * Tav v0.34.N

2013-01-19 20:58  NiLuJe

	* [r9035] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Update binaries (updated TC)

2013-01-19 18:33  NiLuJe

	* [r9028] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Port the autocrop feature from the K5 version

2013-01-19 01:25  NiLuJe

	* [r9012] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Missed this when merging K5 stuff

2013-01-19 00:51  NiLuJe

	* [r9009] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Port a few of the new stuff from the K5 version (black borders, q75)

2013-01-19 00:32  NiLuJe

	* [r9008] src/build-updates.sh, src/install.sh,
	  src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Update for the latest Mobi Cover release
	  Kindle Touch Hacks:
	  * ScreenSavers:
	  * Fix a stupid typo

2012-11-20 16:57  NiLuJe

	* [r8966] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.33.N

2012-11-19 23:31  NiLuJe

	* [r8963] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Do the dithering ourselves.

2012-11-19 18:59  NiLuJe

	* [r8961] src/linkss/bin/cover-extract:
	  
	  Kindle Hacks:
	  * ScreenSaver:
	  * Always use Lanczos when resizing, it's sharper when upscaling

2012-11-15 23:23  NiLuJe

	* [r8953] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.32.N
	  * Fonts:
	  * Tag v5.6.N
	  * USBNetwork:
	  * Tag v0.46.N
	  * Python:
	  * Tag v0.2.N

2012-11-15 22:58  NiLuJe

	* [r8952] src/linkss/bin/convert, src/linkss/bin/inotifywait,
	  src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * TC update. (Bump FT, FC, KT, coreutils, mosh, htop)

2012-11-14 13:40  NiLuJe

	* [r8942] src/linkss/bin/cover-extract,
	  src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * only use the caching workaround we we actually need it (first sleep
	  after a cover switch)

2012-11-14 12:40  NiLuJe

	* [r8941] src/linkss/bin/userstore-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make the kill quiet during the inotify respawn, the spawn itself
	  won't be later, so we'll see it anyway :)

2012-11-14 12:23  NiLuJe

	* [r8940] src/linkss/bin/cover-watchdog, src/linkss/bin/libkh,
	  src/linkss/bin/linkss, src/linkss/bin/screensaver-watchdog,
	  src/linkss/bin/screensaver-watchdog-helper, src/linkss/bin/unlinkss,
	  src/linkss/bin/userstore-watchdog[ADD],
	  src/linkss/bin/userstore-watchdog-helper[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Workaround the USBMS issue in a slightly less braindead way for the
	  cover mode...

2012-11-14 00:18  NiLuJe

	* [r8939] src/linkss/bin/cover-watchdog:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak some comments

2012-11-14 00:12  NiLuJe

	* [r8938] src/linkss/bin/cover-watchdog:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Hmm, more K4 ugly hacks!

2012-11-14 00:01  NiLuJe

	* [r8937] src/linkss/bin/cover-watchdog:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Ugly workaround for the borken inotify watches on USBMS on the K4...

2012-11-13 16:02  NiLuJe

	* [r8934] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Disable update traps

2012-11-10 02:17  NiLuJe

	* [r8900] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Use the new aliases for the whole K4 & K5 model range in every build
	  script

2012-11-09 18:30  NiLuJe

	* [r8898] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.31.N

2012-11-09 14:31  NiLuJe

	* [r8885] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Add 5.3 to the version detect code

2012-11-08 23:16  NiLuJe

	* [r8883] src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Forgot to set PYTHONHOME when generating MU bytecode (apparently not
	  that big of an issue... xD)

2012-11-08 15:48  NiLuJe

	* [r8880] src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Use the cover mode caching workaround when we switch to SS via
	  timeout, too...

2012-11-07 21:32  NiLuJe

	* [r8879] src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Note the possibility of needing a small sleep in some cases...

2012-11-07 21:21  NiLuJe

	* [r8878] src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix caching workaround for cover mode on FW 2.x

2012-11-07 21:16  NiLuJe

	* [r8877] src/linkss/bin/cover-watchdog-helper,
	  src/linkss/bin/screensaver-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak a few comments.

2012-11-07 19:59  NiLuJe

	* [r8876] src/linkss/bin/cover-watchdog-helper, src/linkss/bin/libkh,
	  src/linkss/bin/linkss, src/linkss/bin/screensaver-watchdog[ADD],
	  src/linkss/bin/screensaver-watchdog-helper[ADD],
	  src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Workaround the caching issue with a Big Fucking Gun.... Sigh.

2012-11-07 19:37  NiLuJe

	* [r8875] src/linkss/bin/cover-extract, src/linkss/bin/shuffless:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * revert, doesn't help....

2012-11-07 19:34  NiLuJe

	* [r8874] src/linkss/bin/cover-extract, src/linkss/bin/shuffless:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Try a stupid thing to workaround the caching issue on FW 3.x (at
	  least...)

2012-11-07 19:03  NiLuJe

	* [r8873] src/linkss/bin/cover-extract, src/linkss/bin/cover-watchdog,
	  src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Some more changes to avoid useless parsing in cover mode...

2012-11-07 18:51  NiLuJe

	* [r8872] src/linkss/bin/cover-watchdog,
	  src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * ...or it might just be fsp being annoying...

2012-11-07 18:38  NiLuJe

	* [r8871] src/linkss/bin/cover-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Well, apparently, sleeping is critical.
	  The loop appears to hang after the first event without it
	  (and only when run through the scripts, launching it by hand works
	  fine... o_O)

2012-11-07 17:18  NiLuJe

	* [r8870] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Add Python to the whitelists

2012-11-07 16:14  NiLuJe

	* [r8862] src/build-updates.sh, src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Bundle & Install our trimmed down Mobi Unpack version

2012-11-07 16:08  NiLuJe

	* [r8860] src/linkss/bin/cover-extract, src/linkss/cover_cache[ADD],
	  src/linkss/cover_cache/default-600x800.png[ADD],
	  src/linkss/cover_cache/default-824x1200.png[ADD],
	  src/linkss/overflow[ADD]:
	  
	  Kindle Hacks:
	  * TestUpdate:
	  * Handle latest SS changes

2012-11-07 16:03  NiLuJe

	* [r8859] src/linkss/bin/cover-watchdog-helper, src/linkss/bin/linkss,
	  src/linkss/bin/shuffless, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Finish implementing cover mode :)

2012-11-07 14:49  NiLuJe

	* [r8858] README, src/linkss/bin/cover-extract[ADD],
	  src/linkss/bin/cover-watchdog[ADD],
	  src/linkss/bin/cover-watchdog-helper[ADD], src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Start implementing the cover mode

2012-11-07 14:16  NiLuJe

	* [r8857] src/linkss/bin/convert[ADD], src/linkss/bin/inotifywait[ADD],
	  src/linkss/etc/ImageMagick[ADD],
	  src/linkss/etc/ImageMagick/coder.xml[ADD],
	  src/linkss/etc/ImageMagick/colors.xml[ADD],
	  src/linkss/etc/ImageMagick/delegates.xml[ADD],
	  src/linkss/etc/ImageMagick/log.xml[ADD],
	  src/linkss/etc/ImageMagick/magic.xml[ADD],
	  src/linkss/etc/ImageMagick/mime.xml[ADD],
	  src/linkss/etc/ImageMagick/policy.xml[ADD],
	  src/linkss/etc/ImageMagick/quantization-table.xml[ADD],
	  src/linkss/etc/ImageMagick/thresholds.xml[ADD],
	  src/linkss/etc/ImageMagick/type-dejavu.xml[ADD],
	  src/linkss/etc/ImageMagick/type-ghostscript.xml[ADD],
	  src/linkss/etc/ImageMagick/type-windows.xml[ADD],
	  src/linkss/etc/ImageMagick/type.xml[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Build binaries for the cover-mode on legacy devices...

2012-10-25 18:27  NiLuJe

	* [r8762] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Detect the UK 3G PW

2012-10-16 15:21  NiLuJe

	* [r8700] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Propagate the latest S/N matching changes

2012-10-15 22:55  NiLuJe

	* [r8697] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Fix a stupid bug in model detection via S/N matching:
	  The S/N aren't in base16, they're in base32hex!
	  (at the very least, I might need some more data to confirm that...)

2012-10-12 17:43  NiLuJe

	* [r8694] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v5.5.N
	  * ScreenSavers:
	  * Tag v0.30.N
	  * USBNetwork:
	  * tag v0.44.N

2012-10-12 03:41  NiLuJe

	* [r8688] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Update binaries (Update TC, FT, FC, KT, mosh)

2012-10-04 02:06  NiLuJe

	* [r8655] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Update S/N based model detection logic to handle the US PW ids

2012-10-01 17:36  NiLuJe

	* [r8648] src/linkss/bin/usb-watchdog,
	  src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts/SS:
	  * Use lipc-wait-event instead of dbus-monitor to catch the usbPlugOut
	  event

2012-09-22 18:23  NiLuJe

	* [r8623] ChangeLog[DEL]:
	  
	  Kindle Hacks:
	  * Move ChangeLog generation to the packaging script

2012-09-22 17:53  NiLuJe

	* [r8617] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Resync libkh

2012-09-20 17:00  NiLuJe

	* [r8600] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * Resync libkh

2012-09-20 02:31  NiLuJe

	* [r8598] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-20 01:56  NiLuJe

	* [r8596] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-19 21:38  NiLuJe

	* [r8583] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-19 21:18  NiLuJe

	* [r8580] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-19 00:04  NiLuJe

	* [r8572] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-16 20:48  NiLuJe

	* [r8556] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL :)

2012-09-16 20:30  NiLuJe

	* [r8554] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-16 20:10  NiLuJe

	* [r8550] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-16 03:58  NiLuJe

	* [r8538] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-16 03:42  NiLuJe

	* [r8535] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-16 02:59  NiLuJe

	* [r8531] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v5.3.N
	  * ScreenSavers:
	  * Tag v0.29.N

2012-09-16 02:41  NiLuJe

	* [r8530] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Merge watchdog changes from the Fonts hack

2012-09-16 01:02  NiLuJe

	* [r8524] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-15 21:57  NiLuJe

	* [r8520] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Slightly less stupid K4 packaging logic

2012-09-15 21:52  NiLuJe

	* [r8518] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.28.N

2012-09-15 20:17  NiLuJe

	* [r8510] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Refresh K3 binaries (updated TC)
	  * ScreenSavers:
	  * Updated coreutils
	  * USBNetwork:
	  * Updated KindleTool
	  * Updated htop
	  * Updated busybox
	  * Updated OpenSSH
	  * Updated lsof
	  * Fonts:
	  * Updated FreeType
	  * Updated FontConfig

2012-09-12 22:47  NiLuJe

	* [r8476] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Be consistent on the lowercase/uppercase Kindle nicknames...

2012-09-12 22:43  NiLuJe

	* [r8475] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-09-12 22:43  NiLuJe

	* [r8474] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Build K4 2K12 friendly K4 packages... :)

2012-06-18 16:22  NiLuJe

	* [r8223] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-18 16:21  NiLuJe

	* [r8222] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Go back to non-LTO binaries, to avoid stuff blowing up in the middle
	  of execution because of bad code generation, like I encountered with
	  OpenSSH... ;).

2012-06-18 15:01  NiLuJe

	* [r8218] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-18 15:00  NiLuJe

	* [r8217] src/linkss/bin/shlock:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * More LTO fixes & LTO binaries ;)

2012-06-18 02:32  NiLuJe

	* [r8204] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * USBNet:
	  * Support OpenSSH (with a setting to use it instead of dropbear)

2012-06-17 13:23  NiLuJe

	* [r8197] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Rebuild binaries with LTO...

2012-06-16 04:04  NiLuJe

	* [r8192] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-16 03:17  NiLuJe

	* [r8188] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-16 03:12  NiLuJe

	* [r8186] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Oops, fix K4 packages

2012-06-16 03:05  NiLuJe

	* [r8185] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * USBNet & Fonts & ScreenSavers:
	  * Package the right set of binaries when building the K4 packages

2012-06-16 01:58  NiLuJe

	* [r8183] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-16 01:58  NiLuJe

	* [r8182] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Don't even try to build the K4 packages if KindleTool isn't
	  installed

2012-06-15 16:17  NiLuJe

	* [r8177] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Update all the binaries (built with proper LDFLAGS)

2012-06-14 21:53  NiLuJe

	* [r8164] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Here we go, softfp binaries... (sftp-server is still borken, pulling
	  a glibc 2.8 symbol)

2012-06-14 04:34  NiLuJe

	* [r8155] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Updated binaries (Updated TC, FT, FC)
	  * ScreenSavers:
	  * Updated binaries (Updated TC, coreutils)
	  * USBNet:
	  * Updated binaries (Updated TC, busybox, OpenSSH)
	  * Added mosh binaries (not installed yet)
	  * Added a kindletool binary (not installed yet)
	  **!!** These are built with a hardfloat TC, and require the
	  ld-linux-hardf dynamic loader, so, err, don't run these on your
	  Kindle, it won't work.
	  I'll rebuild everything with a softfp TC tomorrow :)

2012-06-07 05:09  NiLuJe

	* [r8137] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-06 21:31  NiLuJe

	* [r8134] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-06-06 20:35  NiLuJe

	* [r8132] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * *sigh* Fix K4 packages.

2012-06-06 20:16  NiLuJe

	* [r8130] src/build-updates.sh, src/linkss/bin/libkh,
	  src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Package for the K4
	  * Tag v0.27.N

2012-04-28 21:59  NiLuJe

	* [r8079] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Oops, forgot the update_ prefix when building with kindletool...

2012-04-28 21:47  NiLuJe

	* [r8078] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Update buildscripts to use kindletool (if possible) if it's
	  installed (in $PATH)

2012-04-27 02:33  NiLuJe

	* [r8073] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * SS & Fonts:
	  * Update fallback whitelist

2012-03-18 21:52  NiLuJe

	* [r7991] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FT & FC libs (bump ft, fc & TC)
	  * ScreenSavers:
	  * Update binaries (update TC)
	  * USBNetwork:
	  * Update binaries (update TC)

2012-03-07 00:08  NiLuJe

	* [r7979] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-03-03 01:59  NiLuJe

	* [r7973] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-03-03 01:59  NiLuJe

	* [r7972] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v5.0.N
	  * ScreenSavers:
	  * Tag v0.26.N
	  * USBNetwork:
	  * Tag v0.36.N

2012-03-02 23:56  NiLuJe

	* [r7967] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2012-03-02 23:48  NiLuJe

	* [r7966] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * X-TC:
	  * Fix a few things
	  * Updated binaries for everything, yay!

2012-01-09 02:33  NiLuJe

	* [r7870] src/install.sh:
	  
	  Kindle Hacks:
	  * Restore usage of proper options syntax for tar, we never know how
	  buggy the Kindle's one might be ;)

2012-01-09 02:23  NiLuJe

	* [r7869] src/install.sh:
	  
	  Kindle Hacks:
	  * Check for failures after extracting our custom directory in /tmp...
	  (Not sure if we caught failures here before, because of a full tmpfs
	  for example).

2011-11-29 19:53  NiLuJe

	* [r7775] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JB/Fonts/SS:
	  * Update whitelist

2011-11-24 22:13  NiLuJe

	* [r7771] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * X-Compile:
	  * Bump htop patchset, refresh logs
	  * Fonts:
	  * Update ft/fc/shlock binaries (updated TC)
	  * SS:
	  * Update fc/shlock binaries (updated TC)
	  * USBNetwork:
	  * Update sftp-server binary (updated TC)
	  * Update lsof binary (updated patchset, updated TC)
	  * Updated dropbearmulti binary (bump dropbear to 2011.54, updated TC)
	  * Updated htop binary (bump htop to 1.0, updated TC)
	  * Updated busybox binary (bump busybox to 1.19.3, updated TC)
	  * Updated rsync binary (updated TC)

2011-11-19 01:19  NiLuJe

	* [r7740] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Update whitelist
	  * USBNetwork:
	  * Add note about having to tweak the HW address when using multiple
	  Kindles

2011-10-19 02:28  NiLuJe

	* [r7677] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-10-19 02:28  NiLuJe

	* [r7676] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Cut down some more on verbose logging spam

2011-10-19 02:08  NiLuJe

	* [r7675] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-10-19 01:59  NiLuJe

	* [r7674] src/linkss/bin/linkss, src/linkss/bin/shuffless,
	  src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Quiet some kh_msg down when in verbose mode to cut down on the
	  flood.

2011-10-19 01:28  NiLuJe

	* [r7672] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * libkh:
	  * Add a note regarding late eips prints on Kill runlevels.

2011-10-19 00:15  NiLuJe

	* [r7670] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-10-19 00:14  NiLuJe

	* [r7669] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Tag v0.10.N
	  * Fonts:
	  * Tag v4.9.N
	  * ScreenSavers:
	  * Tag v0.25.N
	  * USBnetwork:
	  * Tag v0.35.N

2011-10-19 00:11  NiLuJe

	* [r7668] src/linkss/bin/libkh:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Use libkh

2011-10-18 23:55  NiLuJe

	* [r7666] src/linkss/bin/libkh[CPY], src/linkss/bin/linkss,
	  src/linkss/bin/shuffless, src/linkss/bin/unlinkss,
	  src/linkss/bin/usb-watchdog, src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Use libkh

2011-10-18 21:53  NiLuJe

	* [r7663] src/linkss/bin/shuffless:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Simplify the zero-padding loop.

2011-10-17 23:49  NiLuJe

	* [r7660] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Go Back to -O2 binaries, they're still faster :) (Update benchmarks)

2011-10-17 22:56  NiLuJe

	* [r7659] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Test -Ofast builds for benchmarking purposes

2011-10-17 22:22  NiLuJe

	* [r7658] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FT libs, shlock & fc-scan binaries (updated TC)
	  * ScreenSavers:
	  * Update shlock & sort binaries (updated TC)
	  * USBNetwork:
	  * Update sftp-server, lsof, dropbear, htop, busybox, lsof, rsync
	  binaries (updated TC)
	  * x-compile:
	  * Use parallel make when possible

2011-10-17 05:07  NiLuJe

	* [r7650] src/linkss/bin/usb-watchdog:
	  
	  Kidle Hacks:
	  * Fonts/SS:
	  * Give up on the USB watchdog after 15s. Reset fail counter on
	  success.
	  * Update TODO for tomorrow.

2011-10-17 02:13  NiLuJe

	* [r7645] src/linkss/bin/usb-watchdog:
	  
	  Kindle Hacks:
	  * SS/Fonts:
	  * Fix typos in the usb watchdog comments

2011-10-17 02:04  NiLuJe

	* [r7644] src/linkss/bin/usb-watchdog:
	  
	  Kindle Hacks:
	  * Fonts/ScreenSavers:
	  * Avoid flooding the logs if for some reason the usb watchdog loop
	  can't find
	  its helper script (removed/corrupt link*/bin folder while the hack is
	  still installed/running?)
	  and give up trying after 2 min.

2011-10-11 16:16  NiLuJe

	* [r7634] README:
	  
	  Kindle Hacks:
	  * Update some copyright years in the credits

2011-10-11 16:03  NiLuJe

	* [r7633] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-10-11 16:02  NiLuJe

	* [r7632] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak, Fonts, ScreenSavers:
	  * Update whitelist

2011-10-06 02:11  NiLuJe

	* [r7629] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak, Fonts & ScreenSavers:
	  * Update JB whitelist

2011-09-20 04:32  NiLuJe

	* [r7601] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-17 23:58  NiLuJe

	* [r7596] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-17 23:37  NiLuJe

	* [r7594] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FT libs (FT update)
	  * ScreenSavers:
	  * Update sort binary (coreutils update)
	  * USBNetwork:
	  * Update resync binary (rsync update)
	  * x-compile:
	  * Small fixes to make sure evrything builds :)

2011-09-10 18:24  NiLuJe

	* [r7574] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-10 18:19  NiLuJe

	* [r7572] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-10 18:02  NiLuJe

	* [r7571] src/linkss/bin/shuffless, src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts, SS:
	  * Only show the "shuffling screensavers" status during an autoreboot
	  if we're *actually* suffling screensavers ;).

2011-09-10 17:56  NiLuJe

	* [r7570] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Tag v0.9.N
	  * Fonts:
	  * Tag v0.4.8.N
	  * ScreenSavers:
	  * Tag v0.24.N
	  * Update MR thread

2011-09-10 17:49  NiLuJe

	* [r7569] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Tweak the watchdog to provide visual feedback through eips when
	  triggering an autoreboot.

2011-09-05 14:43  NiLuJe

	* [r7553] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-05 01:52  NiLuJe

	* [r7550] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-09-04 18:47  NiLuJe

	* [r7548] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-08-25 17:49  NiLuJe

	* [r7540] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-08-25 17:31  NiLuJe

	* [r7537] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Update whitelist (and put the blank last line back, *sigh*)
	  * ScreenSavers & Fonts:
	  * Update fallback whitelist

2011-08-22 00:53  NiLuJe

	* [r7533] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2011-08-22 00:48  NiLuJe

	* [r7531] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FT libs (Update TC, FT)
	  * Update shlock bin (TC update)
	  * Update fc-scan bin (Update TC, FC)
	  * ScreenSavers:
	  * Update shlock & sort bins (TC update)
	  * USBNet:
	  * Update rsync bin (Update TC, rsync)
	  * Update busybox bin (Update TC, busybox)
	  * Update sftp-server, lsof, dropbearmulti & htop bins (TC update)

2011-07-26 02:49  NiLuJe

	* [r7514] src/linkss/bin/shuffless, src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Only shuffle screensavers on auto-restarts when the 'shuffle'
	  trigger file
	  is present, instead of the default 'random' one. (In order to avoid
	  potential long delays before the framework actually restarts, if
	  there's
	  a whole bunch of screensavers to move around and the cache is cold)

2011-07-02 15:06  NiLuJe

	* [r7496] src/kindle_update_tool.py:
	  
	  Kindle Hacks:
	  * Update Tool:
	  * Tag v0.12
	  * Hacks:
	  * Use update tool 0.12

2011-06-15 03:25  NiLuJe

	* [r7481] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v4.7.N
	  * ScreenSavers:
	  * Tag v0.23.N

2011-06-15 03:23  NiLuJe

	* [r7480] src/linkss/bin/linkss, src/linkss/bin/shuffless[ADD],
	  src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers & Fonts:
	  * Shuffle screensavers on USB watchdog triggered framework restarts,
	  too.

2011-05-09 04:20  NiLuJe

	* [r7453] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JB & co:
	  * Update whielist/fallback whitelist.

2011-05-03 18:10  NiLuJe

	* [r7450] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-04-20 17:02  NiLuJe

	* [r7433] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-04-20 17:01  NiLuJe

	* [r7432] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Tag JB v0.7.N, SS v0.22.N, Fonts v4.6.N

2011-04-20 16:57  NiLuJe

	* [r7431] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * When checking an update file name against the whitelist,
	  don't always assume it will be in the form name_*.bin...
	  (ie. with that extra underscore there). Fix a bunch of
	  hacks, most notably yifanlu's 3.1 on K2 stuff ;).
	  Thanks to tekkasit on MR for the report :).

2011-04-19 02:51  NiLuJe

	* [r7421] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-04-19 02:48  NiLuJe

	* [r7420] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Tag v0.33.N
	  * Fonts:
	  * Tag v4.5.N
	  * ScreenSavers:
	  * Tag v0.21.N

2011-04-19 02:38  NiLuJe

	* [r7419] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Update whitelist

2011-04-16 03:43  NiLuJe

	* [r7412] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Hmm, trusty -O2 builds... :}

2011-04-16 03:09  NiLuJe

	* [r7410] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * New binaries, new gcc version (still -O3)

2011-04-15 20:23  NiLuJe

	* [r7407] src/linkss/bin/shlock, src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * -O3 binaries. So far, it seems slower...

2011-04-11 02:55  NiLuJe

	* [r7401] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JB, SS, Fonts:
	  * Update whitelist

2011-04-10 00:44  NiLuJe

	* [r7400] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Add KindleNote devkeys to the whitelist
	  * Fonts & ScreenSavers:
	  * Update whitelist

2011-03-23 01:19  NiLuJe

	* [r7379] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-03-23 01:08  NiLuJe

	* [r7377] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-03-23 01:08  NiLuJe

	* [r7376] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Fix the dos2unix sed script to work with busybox's crappy sed
	  implementation
	  * Fonts & ScreenSavers:
	  * Update whitelist
	  * USBNetwork:
	  * Do a dos2unix run on the config file before source'ing it

2011-03-07 21:15  NiLuJe

	* [r7362] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL
	  * Update MR Thread

2011-03-07 20:31  NiLuJe

	* [r7361] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v4.4.N
	  * ScreenSavers:
	  * Tag v0.20.N

2011-03-06 03:19  NiLuJe

	* [r7353] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Use the full whitelist in the fallback whitelist
	  (because we don't install the jailbreak's whitelist on FW 2.x)

2011-03-01 15:12  NiLuJe

	* [r7328] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-03-01 14:52  NiLuJe

	* [r7326] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Update whitelist (with Sir Alex requests)
	  * Made the install process custom config checksum tests way more
	  robust.
	  * Fonts & ScreenSavers:
	  * Use a smaller fallback whitelist

2011-03-01 14:02  NiLuJe

	* [r7325] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-28 19:37  NiLuJe

	* [r7321] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-28 19:37  NiLuJe

	* [r7320] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Oops, forgot to update the checksums in the install script after the
	  whitelist update.
	  * Fonts/ScreenSavers:
	  * Update fallback whitelist.

2011-02-28 16:11  NiLuJe

	* [r7319] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-28 15:41  NiLuJe

	* [r7317] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-28 14:48  NiLuJe

	* [r7315] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-28 14:47  NiLuJe

	* [r7314] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * JailBreak:
	  * Fix whitelist parsing... The Kindle's shell doesn't play nice
	  with unquoted wildcard matches in a test, so use a case switch
	  instead.
	  * Fonts & SCreenSavers:
	  * Fix the update trap tests. (Same issue as the jailbreak).

2011-02-27 20:09  NiLuJe

	* [r7313] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CL

2011-02-27 19:31  NiLuJe

	* [r7312] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Tag v4.3.N
	  * ScreenSavers:
	  * Tag v0.19.N
	  * USBNetwork:
	  * Tag v0.31.N
	  * Update MR Thread

2011-02-27 19:18  NiLuJe

	* [r7311] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update FreeType libs
	  * Update fc-scan
	  * ScreenSavers:
	  * Update sort
	  * USBNetwork:
	  * Update sftp-server
	  * Update dropbear
	  * Update htop
	  * Update busybox
	  * Update rsync
	  * X-TC:
	  * Update to use the latest versions of a whole bunch of stuff ;)

2011-02-27 16:59  NiLuJe

	* [r7309] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Rely on the new jailbreak's hack whitelist for the official update
	  file traps

2010-11-20 00:29  NiLuJe

	* [r7240] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-20 00:28  NiLuJe

	* [r7238] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-19 22:46  NiLuJe

	* [r7236] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-19 22:11  NiLuJe

	* [r7231] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.18.N

2010-11-19 18:42  NiLuJe

	* [r7228] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * It actually works way better when I commit the right file...
	  Fix autoreboot when Fonts hack is not installed... Damn typo.
	  Thanks to lovesangelrn on KB for catching this ;).

2010-11-19 02:03  NiLuJe

	* [r7216] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-19 02:01  NiLuJe

	* [r7214] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-16 04:46  NiLuJe

	* [r7196] ChangeLog:
	  
	  Kindle Hacks:
	  * Udate MR Thread
	  * Update ChangeLogs

2010-11-16 04:21  NiLuJe

	* [r7193] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.17.N
	  * Fonts:
	  * Tag v4.1.N

2010-11-16 02:49  NiLuJe

	* [r7191] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Update sort binary (Updated coreutils)

2010-11-14 21:12  NiLuJe

	* [r7177] src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweak the 'preserving custom content' install logmsg to be a bit
	  more accurate.

2010-11-11 07:33  NiLuJe

	* [r7158] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-11 04:54  NiLuJe

	* [r7156] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-11 04:25  NiLuJe

	* [r7154] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-11-11 02:19  NiLuJe

	* [r7148] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-11-10 22:31  NiLuJe

	* [r7142] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts & SS:
	  * Oops, fix USB watchdog. Of course, shlock needs a non-vfat
	  target to create its lockfile.

2010-11-10 21:59  NiLuJe

	* [r7140] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs
	  * Update MR Thread, in preparation of release.

2010-11-10 21:30  NiLuJe

	* [r7139] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.16.N

2010-11-10 21:27  NiLuJe

	* [r7138] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Kill redundant checks of the custom ss folder.
	  We already do that at the start of the script and abort
	  if the dir is empty/non existent.

2010-11-10 21:24  NiLuJe

	* [r7137] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Do a proper check of /proc/mounts to avoid double-mounts, instead
	  of relying on slightly innacurate file checks.

2010-11-09 21:45  NiLuJe

	* [r7125] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Make sure the shlock binary is exec'able.

2010-11-09 21:40  NiLuJe

	* [r7124] src/linkss/bin/linkss, src/linkss/bin/unlinkss,
	  src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts, SS & USBNet:
	  * Simplify all the redundants if $? -eq 0 tests.
	  That's what an if block already does, tests if the
	  exit status of a list of commands is equal to 0, so there's
	  no need to explicitely re-state that ourselves.
	  Only keep it in the install scripts when there's a subshell involved,
	  because I'm not so sure about the subshell thingy as a test condition
	  ;).

2010-11-09 21:32  NiLuJe

	* [r7123] src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Use shlock in the USB watchdog for a proper locking mechanism to
	  avoid
	  multiple concurrent reboots.

2010-11-09 21:15  NiLuJe

	* [r7122] README, src/linkss/bin/shlock[ADD]:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Add an shlock binary (util from the DragonFy BSD project),
	  in order to use it to provide a somewhat proper locking mechanism
	  for the USB watchdog.

2010-11-07 17:35  NiLuJe

	* [r7113] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts & ScreenSavers:
	  * Don't trap Duokan update files.

2010-11-07 00:44  NiLuJe

	* [r7098] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Update fc-scan binary (Updated TC, FT, FC & half-shared linked)
	  * ScreenSavers:
	  * Update sort binary (Updated TC, Coreutils)
	  * USBNetwork:
	  * Updated all the binaries (Updated TC)
	  * The busybox binary now supports the httpd applet.

2010-10-25 21:51  NiLuJe

	* [r7048] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-25 20:53  NiLuJe

	* [r7046] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-19 20:51  NiLuJe

	* [r7003] ChangeLog:
	  
	  Kindle Hacks:
	  * Update MR Thread for jb release.

2010-10-19 04:06  NiLuJe

	* [r7002] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-18 21:45  NiLuJe

	* [r6996] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-18 20:33  NiLuJe

	* [r6993] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-18 20:31  NiLuJe

	* [r6991] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-18 05:00  NiLuJe

	* [r6987] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-09 21:24  NiLuJe

	* [r6956] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-05 02:31  NiLuJe

	* [r6945] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fots & SS:
	  * Don't backup font_pkg updates

2010-10-04 23:00  NiLuJe

	* [r6941] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLog

2010-10-04 20:31  NiLuJe

	* [r6938] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-04 18:22  NiLuJe

	* [r6933] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.15.N

2010-10-04 18:20  NiLuJe

	* [r6932] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Only mount the screensavers for our actual device,
	  based on it's screen resolution.

2010-10-02 03:33  NiLuJe

	* [r6928] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-02 03:12  NiLuJe

	* [r6926] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-10-01 16:27  NiLuJe

	* [r6923] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-30 21:15  NiLuJe

	* [r6914] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs
	  * Packager:
	  * Package the font packager

2010-09-30 16:53  NiLuJe

	* [r6910] ChangeLog:
	  
	  Kindle Hacks:
	  * Update Cls
	  * Update MR Thread

2010-09-29 20:43  NiLuJe

	* [r6905] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-28 19:14  NiLuJe

	* [r6901] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-28 16:18  NiLuJe

	* [r6896] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-27 22:23  NiLuJe

	* [r6893] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-27 19:45  NiLuJe

	* [r6889] src/linkss/bin/usb-watchdog:
	  
	  Kindle Hacks:
	  * Fonts & SS
	  * Narrow down a bit the dbus-monitor watch expression for the USB
	  watchdog.

2010-09-27 18:20  NiLuJe

	* [r6888] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-26 14:49  NiLuJe

	* [r6884] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-26 01:47  NiLuJe

	* [r6879] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-25 22:41  NiLuJe

	* [r6873] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-24 12:40  NiLuJe

	* [r6857] README[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Forgot to commit that

2010-09-24 00:52  NiLuJe

	* [r6855] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-23 23:17  NiLuJe

	* [r6848] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-09-23 23:16  NiLuJe

	* [r6847] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Tag Fonts v3.9.N
	  * Tag ScreenSavers v0.14.N
	  * Tag USBNet v0.13.N

2010-09-23 23:11  NiLuJe

	* [r6845] src/install.sh:
	  
	  Kindle Hacks:
	  * Fonts & Screensavers:
	  * And make the install script handle the config files migration

2010-09-23 23:03  NiLuJe

	* [r6844] src/linkss/bin/linkss, src/linkss/etc[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Move prettyversion.txt to etc
	  * Fonts:
	  * Move all the config files to etc

2010-09-23 22:54  NiLuJe

	* [r6843] src/linkss/bin/linkss, src/linkss/bin/unlinkss,
	  src/linkss/bin/usb-watchdog, src/linkss/bin/usb-watchdog-helper,
	  src/linkss/run[ADD]:
	  
	  Kindle Hacks:
	  * Fonts & SS:
	  * Move pid & lockfiles to the run folder

2010-09-23 21:39  NiLuJe

	* [r6838] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Compile fc-scan dynamically (save ~600ko per model)
	  * ScreenSavers:
	  * Compile sort dynamically (save ~650ko per model)
	  * x-compile:
	  * Rebuild FT/FC & coreutils dynamically :).

2010-09-21 23:56  NiLuJe

	* [r6826] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-21 23:32  NiLuJe

	* [r6822] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-21 20:38  NiLuJe

	* [r6812] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-21 18:17  NiLuJe

	* [r6806] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-21 18:15  NiLuJe

	* [r6805] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tag v0.13.N

2010-09-21 18:10  NiLuJe

	* [r6804] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix (once again...) the randomizing of screensavers with a space
	  in their filename...

2010-09-21 15:34  NiLuJe

	* [r6800] ChangeLog:
	  
	  Kindle Hacks:
	  * Update Cls.
	  * Update MR Thread.

2010-09-21 15:27  NiLuJe

	* [r6799] src/linkss/bin/sort:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * It's even better if my sort binary can actually run on
	  K2 devices, and not only on K3... ;)

2010-09-21 12:14  NiLuJe

	* [r6793] src/build-updates.sh, src/linkss/bin/linkss,
	  src/linkss/bin/sort[ADD], src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Properly and truly randomize the screensavers when asked to.
	  (Using coreutils' sort instead of a crappy inacurate shell workaround)
	  * Tag v0.12.N

2010-09-19 23:39  NiLuJe

	* [r6777] ChangeLog:
	  
	  Kindle Hacks:
	  * Update MR thread
	  * Update CLs

2010-09-18 23:57  NiLuJe

	* [r6768] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-18 21:16  NiLuJe

	* [r6766] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-09-18 21:16  NiLuJe

	* [r6765] src/build-updates.sh, src/kindle_update_tool.py,
	  src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Build for K3 devices
	  * Tag v0.11.N
	  * Update MR thread

2010-09-18 21:07  NiLuJe

	* [r6764] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-08-30 00:45  NiLuJe

	* [r6685] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-08-30 00:43  NiLuJe

	* [r6683] src/build-updates.sh:
	  
	  Kindle Hacks:
	  * Use variables instead of having to repeat the name of the hack
	  multiple times

2010-08-11 03:22  NiLuJe

	* [r6633] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-08-10 22:38  NiLuJe

	* [r6631] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-10 21:32  NiLuJe

	* [r6629] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-10 21:28  NiLuJe

	* [r6627] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-10 21:19  NiLuJe

	* [r6624] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-08-07 03:54  NiLuJe

	* [r6615] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-07 03:49  NiLuJe

	* [r6613] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-07 03:47  NiLuJe

	* [r6612] src/install.sh:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * And fix custom directory install here too.
	  * Fonts/SS:
	  * And, no, we don't need to wrap the exclude list var inside an echo.
	  I really need to sleep. -_-"

2010-08-07 03:35  NiLuJe

	* [r6611] src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Huh. Fix install custom content filtering.
	  * Fonts:
	  * Like SS, fix custom directory install.

2010-08-07 03:29  NiLuJe

	* [r6610] src/build-updates.sh, src/install.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix install of custom directory. Of course we don't have GNU tar.
	  I'm stupid. Well, instead of using pretty GNU tar features, do it
	  like the official updates, a tmp dir and a double tape.

2010-08-07 01:58  NiLuJe

	* [r6608] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-08-06 23:23  NiLuJe

	* [r6602] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-08-06 23:17  NiLuJe

	* [r6599] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts & SS:
	  * Forgot to specify log level in the skip trap message

2010-08-06 23:11  NiLuJe

	* [r6597] src/install.sh:
	  
	  Kindle Hacks:
	  * USBNetwork:
	  * Package & install usbnet custom directory in the update binfile

2010-08-06 21:42  NiLuJe

	* [r6594] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Tag SS v0.10.N & Fonts v3.7.N

2010-08-06 21:00  NiLuJe

	* [r6592] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * SS & Fonts:
	  * Don't trap the update files of our own hacks

2010-08-06 20:50  NiLuJe

	* [r6591] src/build-updates.sh, src/install.sh, src/uninstall.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Package & install linkss directory in the update file.
	  (No need to copy it manually over USB anymore).
	  And we try to leave user's custom content alone.
	  * Log install/uninstall to syslog

2010-07-28 21:28  NiLuJe

	* [r6576] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-07-28 21:23  NiLuJe

	* [r6574] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-20 20:28  NiLuJe

	* [r6563] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-20 20:28  NiLuJe

	* [r6562] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Tag v0.9.N & v3.6.N

2010-07-20 20:12  NiLuJe

	* [r6561] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-20 20:12  NiLuJe

	* [r6560] ChangeLog, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts & SS:
	  * *sigh* Trap official updates too. (case issue)

2010-07-20 19:27  NiLuJe

	* [r6559] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Use a case switch instead of nested for loops

2010-07-20 19:18  NiLuJe

	* [r6558] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Made the double-mount safety check faster/more robust.

2010-07-20 00:18  NiLuJe

	* [r6554] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-20 00:18  NiLuJe

	* [r6553] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix double-mount check when used in conjunction with the randomizer

2010-07-19 23:19  NiLuJe

	* [r6552] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLog

2010-07-19 23:18  NiLuJe

	* [r6551] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Hmm, fix a big bad typo breaking the stop script -_-"
	  (forgot an if.... >_<")

2010-07-19 22:50  NiLuJe

	* [r6550] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-19 22:50  NiLuJe

	* [r6549] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Bump ScreenSavers to 0.8.N
	  * Bump Fonts to 3.5.N

2010-07-19 22:45  NiLuJe

	* [r6548] src/linkss-init, src/linkss/bin/linkss,
	  src/linkss/bin/unlinkss, src/linkss/bin/usb-watchdog,
	  src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Like the fonts hack, use the system logger.

2010-07-19 21:52  NiLuJe

	* [r6546] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Kill on stop with a SIGKILL, and not a SIGTERM.
	  We take care of cleanup ourselves anyway, so, better be safe,
	  and really kill, than having stale processes.

2010-07-19 21:47  NiLuJe

	* [r6545] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix another typo in comments

2010-07-19 21:42  NiLuJe

	* [r6544] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers;
	  * Fix a typo in comments

2010-07-19 21:39  NiLuJe

	* [r6543] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Avoid a bunch of fork/ls output parsing by using shell globbing
	  instead

2010-07-19 20:07  NiLuJe

	* [r6541] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Only randomize files, not directories...

2010-07-19 19:57  NiLuJe

	* [r6539] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Use SIGTERM instead of SIGKILL, it should be enough.
	  * Update TODO

2010-07-19 19:53  NiLuJe

	* [r6538] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Properly quote path wich may contain spaces or special characters.
	  Fix randomization if your screensavers filenames had spaces in them.

2010-07-18 04:52  NiLuJe

	* [r6530] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-12 04:39  NiLuJe

	* [r6520] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-11 22:51  NiLuJe

	* [r6516] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-11 22:50  NiLuJe

	* [r6515] src/build-updates.sh, src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Bump ScreenSavers to v0.7.N
	  * Bump Fonts to v3.4.N

2010-07-11 22:33  NiLuJe

	* [r6514] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fix /etc/prettyversion unmounting. We can't use the source
	  of the mount for umount, because the Kindle uses a weird Fuse
	  plugin... Anyway, must use the target of the mount point.
	  And apparently, the Kindle's umount doesn't whine whith
	  double mounts, so it's safe ;)
	  That effectively made the hacks non update-safe if you had
	  a prettyversion.txt override...

2010-07-11 22:28  NiLuJe

	* [r6513] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Remove ssviewer. Doesn't work, the mount is done by root,
	  GUI doesn't have sufficient permission.
	  Or something like that. Doesn't really care to investigate xD

2010-07-11 21:46  NiLuJe

	* [r6510] src/linkss/bin/linkss, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fairly useless new feature: If there's a viewer trigger file,
	  the custom ss dir will be mounted inside the pictures folder,
	  thus being viewable via the Kindle's pictureviewer...

2010-07-11 21:36  NiLuJe

	* [r6509] src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fix another typo in a comment

2010-07-11 21:35  NiLuJe

	* [r6508] src/linkss/bin/linkss, src/linkss/bin/unlinkss,
	  src/linkss/bin/usb-watchdog, src/linkss/bin/usb-watchdog-helper:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Use the new usb-watchdog start/stop code from Fonts

2010-07-09 18:15  NiLuJe

	* [r6482] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-09 18:15  NiLuJe

	* [r6481] src/linkss/screensavers/00_kindle_def_600.png[DEL],
	  src/linkss/screensavers/00_you_can_delete_me.png[CPY]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Tweaked the default custom screensaver to make it more obvious that
	  it
	  in fact is a custom screensaver, and that the hack was successfully
	  installed.

2010-07-09 15:46  NiLuJe

	* [r6480] src/kindle_update_tool.py:
	  
	  Kindle Hacks:
	  * Yep. KDX Graphite support works.

2010-07-09 04:31  NiLuJe

	* [r6479] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-09 04:31  NiLuJe

	* [r6478] src/kindle_update_tool.py:
	  
	  Kindle Hacks:
	  * DXg support... Take three.

2010-07-08 22:14  NiLuJe

	* [r6477] src/kindle_update_tool.py:
	  
	  Kindle Hacks:
	  * DXG support, take two. (probably won't work either).

2010-07-08 20:05  NiLuJe

	* [r6475] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-08 20:04  NiLuJe

	* [r6474] src/build-updates.sh, src/kindle_update_tool.py:
	  
	  Kindle Hacks:
	  * Add Kindle DX Graphite support (And hopefully actually working...
	  ^^)

2010-07-05 03:32  NiLuJe

	* [r6463] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLog

2010-07-05 03:29  NiLuJe

	* [r6462] src/linkss/info.txt:
	  
	  Kindle Hacks:
	  * Update version tag in the info.txt file

2010-07-05 02:49  NiLuJe

	* [r6460] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs for the quick fix releases (v3.3.N & v0.6.N).
	  Forgot to zero-pad the kill init level var. *sigh*

2010-07-05 02:23  NiLuJe

	* [r6459] src/build-updates.sh, src/install.sh, src/uninstall.sh:
	  
	  Kindle Hacks:
	  * Fonts & SS:
	  * Oops. Fix the update-safe & update trap feature.

2010-07-04 23:09  NiLuJe

	* [r6457] ChangeLog:
	  
	  Kindle Hacks:
	  * Update ChangeLogs

2010-07-04 20:09  NiLuJe

	* [r6454] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Make it possible to optionnaly randomize screensavers on boot

2010-07-04 17:27  NiLuJe

	* [r6452] src/build-updates.sh, src/linkss/bin/unlinkss:
	  
	  Kindle Hacks:
	  * Fonts:
	  * Bump to 3.2.N
	  * Use the correct mask for update trapping
	  * ScreenSavers:
	  * Bump to 0.5.N
	  * Use the correct mask for update trapping

2010-07-04 02:08  NiLuJe

	* [r6447] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Fix usb watchdog starting tests.

2010-07-04 02:04  NiLuJe

	* [r6446] src/linkss/bin/linkss, src/linkss/bin/unlinkss,
	  src/linkss/bin/usb-watchdog[ADD],
	  src/linkss/bin/usb-watchdog-helper[ADD]:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * And finish merging the new features from Fonts:
	  * USB watchdog & anti double-mounts

2010-07-04 01:36  NiLuJe

	* [r6445] src/install.sh, src/linkss-init, src/linkss/autoreboot[ADD],
	  src/linkss/bin/linkss, src/linkss/bin/unlinkss[ADD], src/uninstall.sh:
	  
	  Kindle Hacks:
	  * ScreenSavers:
	  * Initial merge of the new features from Fonts:
	  * Install/Uninstall
	  * Proper unmount of shutdown/reboot/update

2010-07-03 21:18  NiLuJe

	* [r6437] ChangeLog:
	  
	  Kindle Hacks:
	  * Update CLs

2010-07-03 21:17  NiLuJe

	* [r6436] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * SS:
	  * Avoid possible error with empty string in a compound test
	  * Fonts:
	  * Trust the return status instead of the stdout of kill
	  * Avoid possible error with empty string in a compound test

2010-07-02 01:46  NiLuJe

	* [r6420] src/linkss/bin/linkss:
	  
	  Kindle Hacks:
	  * Redirect error output of forked process to dev/null (ls)
	  * Fonts:
	  * Trap update files on shutdown (so we can take a look
	  at official OTA updates later without fuss)

2010-07-01 18:36  NiLuJe

	* [r6418] ChangeLog:
	  
	  Kindle Hacks:
	  * Tweak ChangeLog gen

2010-07-01 18:33  NiLuJe

	* [r6417] ChangeLog[ADD]:
	  
	  Kindle Hacks:
	  * Add a full ChangeLog :)

2010-07-01 18:20  NiLuJe

	* [r6416] src/build-updates.sh, src/install.sh, src/linkss-init,
	  src/linkss/bin/linkss, src/linkss/info.txt[ADD], src/uninstall.sh,
	  update_ss_0.4.N_k2i_install.bin[DEL],
	  update_ss_0.4.N_k2i_uninstall.bin[DEL]:
	  
	  Kindle:
	  * Hacks:
	  * Add info.txt file for Fonts & SS hacks to their respective
	  custom folder, with a link to the MR posts.
	  * Add Id svn keywords to each custom shell scripts

2010-07-01 18:07  NiLuJe

	* [r6415] src/build-updates.sh:
	  
	  Kindle:
	  * Make zip from a SVN checkout to avoid issue like with the first
	  release...
	  * Use dx/dxi instead of k3/k3i to avoid confusion with the new DX
	  graphite and
	  the probably upcoming 'real' k3.
	  * Fonts:
	  * USB Watchdog:
	  * Sleep for 10 seconds to let everything settle (and give us a
	  chance to do a physical reset if things go wrong)

2010-06-23 00:02  NiLuJe

	* [r6408] src/linkss/bin/linkss:
	  
	  Kindle:
	  * Fonts & SS:
	  * Ditch tabs

2010-06-22 22:52  NiLuJe

	* [r6407] src/linkss/bin/linkss:
	  
	  Kindle:
	  * ScreenSavers:
	  * Add a sanity check, abort if we don't have any custom screensavers

2010-06-22 22:12  NiLuJe

	* [r6404] update_ss_0.4.N_k2i_install.bin,
	  update_ss_0.4.N_k2i_uninstall.bin:
	  
	  Kindle:
	  * Refresh SS & Fonts bin

2010-06-22 16:53  NiLuJe

	* [r6400] src/linkss-init, src/linkss/AUTO[DEL], src/linkss/BACKUP[DEL],
	  src/linkss/auto[CPY], src/linkss/backup[CPY], src/linkss/bin/linkss,
	  update_ss_0.4.N_k2i_install.bin, update_ss_0.4.N_k2i_uninstall.bin:
	  
	  Kindle:
	  * Fonts & ScreenSavers:
	  * Use lowercase trigger files, to avoid issues with
	  systems mounting vfat as all-lowercase

2010-06-21 23:20  NiLuJe

	* [r6394] src/install.sh, update_ss_0.4.N_k2i_install.bin,
	  update_ss_0.4.N_k2i_uninstall.bin:
	  
	  Kindle:
	  * Fonts & ScreenSavers:
	  * More tiny formatting cleanups

2010-06-21 23:17  NiLuJe

	* [r6393] src/install.sh, src/linkss-init, src/uninstall.sh,
	  update_ss_0.4.N_k2i_install.bin, update_ss_0.4.N_k2i_uninstall.bin:
	  
	  Kindle:
	  * ScreenSavers:
	  * Tiny formatting cleanups

2010-06-21 22:58  NiLuJe

	* [r6390] src/linkss/backup[DEL], src/linkss/backups[CPY],
	  src/linkss/bin/linkss:
	  
	  Kindle:
	  * ScreenSavers:
	  * Factorize the script a bit.
	  * Fix backup feature. Crappy FAT.

2010-06-21 19:01  NiLuJe

	* [r6389] src/linkss/bin/linkss:
	  
	  Kindle:
	  * ScreenSavers:
	  * Fix deletion of mac ._* files

2010-06-20 23:52  NiLuJe

	* [r6388] .[ADD], src[ADD], src/build-updates.sh[ADD],
	  src/install.sh[ADD], src/kindle_update_tool.py[ADD], src/linkss[ADD],
	  src/linkss-init[ADD], src/linkss/AUTO[ADD], src/linkss/BACKUP[ADD],
	  src/linkss/backup[ADD], src/linkss/backup/600x800[ADD],
	  src/linkss/backup/824x1200[ADD], src/linkss/bin[ADD],
	  src/linkss/bin/linkss[ADD], src/linkss/screensavers[ADD],
	  src/linkss/screensavers/00_kindle_def_600.png[ADD],
	  src/uninstall.sh[ADD], update_ss_0.4.N_k2i_install.bin[ADD],
	  update_ss_0.4.N_k2i_uninstall.bin[ADD]:
	  
	  

